CAS 32888-86-1 is the registry number for Dimethyl 2-chloro-5-nitroterephthalate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Dimethyl 2-chloro-5-nitrobenzene-1,4-dicarboxylate (CAS 32888-86-1) is a chemical compound with the molecular formula C10H8ClNO6 and a molecular weight of 273.62 g/mol. IUPAC name: dimethyl 2-chloro-5-nitrobenzene-1,4-dicarboxylate. InChIKey: SOWILPWTOKVAII-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO6 |
|---|---|
| Molecular weight | 273.62 g/mol |
| IUPAC name | dimethyl 2-chloro-5-nitrobenzene-1,4-dicarboxylate |
| InChIKey | SOWILPWTOKVAII-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1Cl)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)