CAS 32889-45-5 appears in our catalog under these names: 4,6-Dichloro-n-cyclopropyl-1,3,5-triazin-2-amine, 95%, 4,6-Dichloro-N-cyclopropyl-1,3,5-triazin-2-amine, 95+%, 2-N-cyclopropylamino-4,6-dichloro triazine, 4,6-Dichloro-N-cyclopropyl-1,3,5-triazin-2-amine, ≥95%, ≥95%, 4,6-Dichloro-N-cyclopropyl-1,3,5-triazin-2-amine. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 25g, 10g, 1g, 0,5g.
4,6-dichloro-N-cyclopropyl-1,3,5-triazin-2-amine (CAS 32889-45-5) is a chemical compound with the molecular formula C6H6Cl2N4 and a molecular weight of 205.04 g/mol. IUPAC name: 4,6-dichloro-N-cyclopropyl-1,3,5-triazin-2-amine. InChIKey: BFZPFVIKDQXXKY-UHFFFAOYSA-N.
| Molecular formula | C6H6Cl2N4 |
|---|---|
| Molecular weight | 205.04 g/mol |
| IUPAC name | 4,6-dichloro-N-cyclopropyl-1,3,5-triazin-2-amine |
| InChIKey | BFZPFVIKDQXXKY-UHFFFAOYSA-N |
| SMILES | C1CC1NC2=NC(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)