CAS 328969-78-4 is the registry number for (R)-2-(Adamantan-1-yl)-2-aminoethanol, 97%. Offered by: AmBeed. Available pack sizes: 25g.
(2R)-2-(1-adamantyl)-2-aminoethanol (CAS 328969-78-4) is a chemical compound with the molecular formula C12H21NO and a molecular weight of 195.30 g/mol. IUPAC name: (2R)-2-(1-adamantyl)-2-aminoethanol. InChIKey: HBUUJKSRVMGCEK-CRCJWISWSA-N.
| Molecular formula | C12H21NO |
|---|---|
| Molecular weight | 195.30 g/mol |
| IUPAC name | (2R)-2-(1-adamantyl)-2-aminoethanol |
| InChIKey | HBUUJKSRVMGCEK-CRCJWISWSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)[C@H](CO)N |
Computed by PubChem (NCBI)