CAS 328998-53-4 appears in our catalog under these names: inS3-54A18, 98%, inS3-54A18/ 99.54% (existing batch purity), inS3–54A18, inS3-54A18 99%, InS3-54A18, 99%, 99%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 2mg, 10mg, 25mg, 50mg, 100mg, 500mg.
(3Z)-3-[(4-chlorophenyl)methylidene]-1-(4-hydroxyphenyl)-5-phenylpyrrol-2-one (CAS 328998-53-4) is a chemical compound with the molecular formula C23H16ClNO2 and a molecular weight of 373.8 g/mol. IUPAC name: (3Z)-3-[(4-chlorophenyl)methylidene]-1-(4-hydroxyphenyl)-5-phenylpyrrol-2-one. InChIKey: IMHWQIPPIXOVRK-JXAWBTAJSA-N.
| Molecular formula | C23H16ClNO2 |
|---|---|
| Molecular weight | 373.8 g/mol |
| IUPAC name | (3Z)-3-[(4-chlorophenyl)methylidene]-1-(4-hydroxyphenyl)-5-phenylpyrrol-2-one |
| InChIKey | IMHWQIPPIXOVRK-JXAWBTAJSA-N |
| SMILES | C1=CC=C(C=C1)C2=C/C(=C/C3=CC=C(C=C3)Cl)/C(=O)N2C4=CC=C(C=C4)O |
Computed by PubChem (NCBI)