CAS 329-20-4 appears in our catalog under these names: 4-(Acetylamino)benzenesulfonyl fluoride, 95%, p-Acetamidobenzenesulfonyl fluoride, 95-<97%, p-Acetamidobenzenesulfonyl fluoride, ≥97-<99%. Offered by: Combi-blocks, Hoffman Fine Chemicals. Available pack sizes: 10g, 5g, 1g, 25g, 50g, 100g, 200g.
4-acetamidobenzenesulfonyl fluoride (CAS 329-20-4) is a chemical compound with the molecular formula C8H8FNO3S and a molecular weight of 217.22 g/mol. IUPAC name: 4-acetamidobenzenesulfonyl fluoride. InChIKey: HRQHLUBMODFETM-UHFFFAOYSA-N.
| Molecular formula | C8H8FNO3S |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 4-acetamidobenzenesulfonyl fluoride |
| InChIKey | HRQHLUBMODFETM-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)F |
Computed by PubChem (NCBI)