CAS 329-39-5 is the registry number for N,N-Dibenzylguanidine hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1,1-dibenzylguanidine;hydrochloride (CAS 329-39-5) is a chemical compound with the molecular formula C15H18ClN3 and a molecular weight of 275.77 g/mol. IUPAC name: 1,1-dibenzylguanidine;hydrochloride. InChIKey: AFFSNPJQFHVPSX-UHFFFAOYSA-N.
| Molecular formula | C15H18ClN3 |
|---|---|
| Molecular weight | 275.77 g/mol |
| IUPAC name | 1,1-dibenzylguanidine;hydrochloride |
| InChIKey | AFFSNPJQFHVPSX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(CC2=CC=CC=C2)C(=N)N.Cl |
Computed by PubChem (NCBI)