CAS 329-53-3 is the registry number for Lisinopril Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2,6-bis[(2,2,2-trifluoroacetyl)amino]hexanoic acid (CAS 329-53-3) is a chemical compound with the molecular formula C10H12F6N2O4 and a molecular weight of 338.20 g/mol. IUPAC name: (2S)-2,6-bis[(2,2,2-trifluoroacetyl)amino]hexanoic acid. InChIKey: CMASOZDUMXUWEJ-YFKPBYRVSA-N.
| Molecular formula | C10H12F6N2O4 |
|---|---|
| Molecular weight | 338.20 g/mol |
| IUPAC name | (2S)-2,6-bis[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
| InChIKey | CMASOZDUMXUWEJ-YFKPBYRVSA-N |
| SMILES | C(CCNC(=O)C(F)(F)F)C[C@@H](C(=O)O)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)