Products 329-53-3

CAS 329-53-3 is the registry number for Lisinopril Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S)-2,6-bis[(2,2,2-trifluoroacetyl)amino]hexanoic acid (CAS 329-53-3) is a chemical compound with the molecular formula C10H12F6N2O4 and a molecular weight of 338.20 g/mol. IUPAC name: (2S)-2,6-bis[(2,2,2-trifluoroacetyl)amino]hexanoic acid. InChIKey: CMASOZDUMXUWEJ-YFKPBYRVSA-N.

Identity
Molecular formulaC10H12F6N2O4
Molecular weight338.20 g/mol
IUPAC name(2S)-2,6-bis[(2,2,2-trifluoroacetyl)amino]hexanoic acid
InChIKeyCMASOZDUMXUWEJ-YFKPBYRVSA-N
SMILESC(CCNC(=O)C(F)(F)F)C[C@@H](C(=O)O)NC(=O)C(F)(F)F

Computed by PubChem (NCBI)