CAS 32909-49-2 is the registry number for Pivaloyl-L-proline, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-1-(2,2-dimethylpropanoyl)pyrrolidine-2-carboxylic acid (CAS 32909-49-2) is a chemical compound with the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. IUPAC name: (2S)-1-(2,2-dimethylpropanoyl)pyrrolidine-2-carboxylic acid. InChIKey: PKLZSYAHHJSOFE-ZETCQYMHSA-N.
| Molecular formula | C10H17NO3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | (2S)-1-(2,2-dimethylpropanoyl)pyrrolidine-2-carboxylic acid |
| InChIKey | PKLZSYAHHJSOFE-ZETCQYMHSA-N |
| SMILES | CC(C)(C)C(=O)N1CCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)