CAS 329221-31-0 is the registry number for 5-Bromo-N-(3-cyano-4,5-dimethylthiophen-2-yl)furan-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-N-(3-cyano-4,5-dimethylthiophen-2-yl)furan-2-carboxamide (CAS 329221-31-0) is a chemical compound with the molecular formula C12H9BrN2O2S and a molecular weight of 325.18 g/mol. IUPAC name: 5-bromo-N-(3-cyano-4,5-dimethylthiophen-2-yl)furan-2-carboxamide. InChIKey: SFTYBGCSHTUZQA-UHFFFAOYSA-N.
| Molecular formula | C12H9BrN2O2S |
|---|---|
| Molecular weight | 325.18 g/mol |
| IUPAC name | 5-bromo-N-(3-cyano-4,5-dimethylthiophen-2-yl)furan-2-carboxamide |
| InChIKey | SFTYBGCSHTUZQA-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1C#N)NC(=O)C2=CC=C(O2)Br)C |
Computed by PubChem (NCBI)