CAS 329221-34-3 is the registry number for COR627. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 2-(adamantane-1-carbonylamino)-4-ethyl-5-methylthiophene-3-carboxylate (CAS 329221-34-3) is a chemical compound with the molecular formula C20H27NO3S and a molecular weight of 361.5 g/mol. IUPAC name: methyl 2-(adamantane-1-carbonylamino)-4-ethyl-5-methylthiophene-3-carboxylate. InChIKey: NRZDWDWUMMFBOW-UHFFFAOYSA-N.
| Molecular formula | C20H27NO3S |
|---|---|
| Molecular weight | 361.5 g/mol |
| IUPAC name | methyl 2-(adamantane-1-carbonylamino)-4-ethyl-5-methylthiophene-3-carboxylate |
| InChIKey | NRZDWDWUMMFBOW-UHFFFAOYSA-N |
| SMILES | CCC1=C(SC(=C1C(=O)OC)NC(=O)C23CC4CC(C2)CC(C4)C3)C |
Computed by PubChem (NCBI)