Products 329351-43-1

CAS 329351-43-1 is the registry number for 5-Amino-1h-pyrazole-4-carboxylic amide sulfate, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

5-amino-1H-pyrazole-4-carboxamide;sulfuric acid (CAS 329351-43-1) is a chemical compound with the molecular formula C4H8N4O5S and a molecular weight of 224.20 g/mol. IUPAC name: 5-amino-1H-pyrazole-4-carboxamide;sulfuric acid. InChIKey: RHMSRJURIHDMNK-UHFFFAOYSA-N.

Identity
Molecular formulaC4H8N4O5S
Molecular weight224.20 g/mol
IUPAC name5-amino-1H-pyrazole-4-carboxamide;sulfuric acid
InChIKeyRHMSRJURIHDMNK-UHFFFAOYSA-N
SMILESC1=NNC(=C1C(=O)N)N.OS(=O)(=O)O

Computed by PubChem (NCBI)