CAS 32958-55-7 is the registry number for Trans-3,3,5-trimethylcyclohexanamine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,5S)-3,3,5-trimethylcyclohexan-1-amine (CAS 32958-55-7) is a chemical compound with the molecular formula C9H19N and a molecular weight of 141.25 g/mol. IUPAC name: trans-(1R,5S)-3,3,5-trimethylcyclohexan-1-amine. InChIKey: ZGMQLPDXPUINCQ-HTQZYQBOSA-N.
| Molecular formula | C9H19N |
|---|---|
| Molecular weight | 141.25 g/mol |
| IUPAC name | trans-(1R,5S)-3,3,5-trimethylcyclohexan-1-amine |
| InChIKey | ZGMQLPDXPUINCQ-HTQZYQBOSA-N |
| SMILES | C[C@@H]1C[C@H](CC(C1)(C)C)N |
Computed by PubChem (NCBI)