CAS 3296-05-7 appears in our catalog under these names: 1–Azido–4–chlorobenzene solution, 1-AZIDO-4-CHLOROBENZENE SOLUTION. Offered by: GLPBio, Sigma-Aldrich. Available pack sizes: 10ml, 50ml.
1-azido-4-chlorobenzene (CAS 3296-05-7) is a chemical compound with the molecular formula C6H4ClN3 and a molecular weight of 153.57 g/mol. IUPAC name: 1-azido-4-chlorobenzene. InChIKey: HZVGOEUGZJFTNN-UHFFFAOYSA-N.
| Molecular formula | C6H4ClN3 |
|---|---|
| Molecular weight | 153.57 g/mol |
| IUPAC name | 1-azido-4-chlorobenzene |
| InChIKey | HZVGOEUGZJFTNN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=[N+]=[N-])Cl |
Computed by PubChem (NCBI)