CAS 329695-38-7 appears in our catalog under these names: (2-[(Thien-2-ylcarbonyl)amino]-1,3-thiazol-4-yl)acetic acid, 95%, 2-(2-(Thiophene-2-carboxamido)thiazol-4-yl)acetic acid, 97%, 2-(2-(Thiophene-2-amido)-1,3-thiazol-4-yl)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-[2-(thiophene-2-carbonylamino)-1,3-thiazol-4-yl]acetic acid (CAS 329695-38-7) is a chemical compound with the molecular formula C10H8N2O3S2 and a molecular weight of 268.3 g/mol. IUPAC name: 2-[2-(thiophene-2-carbonylamino)-1,3-thiazol-4-yl]acetic acid. InChIKey: COFSNHOVGDBKIH-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3S2 |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | 2-[2-(thiophene-2-carbonylamino)-1,3-thiazol-4-yl]acetic acid |
| InChIKey | COFSNHOVGDBKIH-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=O)NC2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)