Products 329743-61-5
CAS 329743-61-5 is the registry number for tert–Butyl (S)–2–((4–iodophenyl)carbamoyl)pyrrolidine–1–carboxylate. Offered by: GLPBio. Available pack sizes: 100mg.
Tert-butyl (2S)-2-[(4-iodophenyl)carbamoyl]pyrrolidine-1-carboxylate (CAS 329743-61-5) is a chemical compound with the molecular formula C16H21IN2O3 and a molecular weight of 416.25 g/mol. IUPAC name: tert-butyl (2S)-2-[(4-iodophenyl)carbamoyl]pyrrolidine-1-carboxylate. InChIKey: MFHCMQBVFFADKD-ZDUSSCGKSA-N.
| Molecular formula | C16H21IN2O3 |
|---|---|
| Molecular weight | 416.25 g/mol |
| IUPAC name | tert-butyl (2S)-2-[(4-iodophenyl)carbamoyl]pyrrolidine-1-carboxylate |
| InChIKey | MFHCMQBVFFADKD-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)NC2=CC=C(C=C2)I |
Computed by PubChem (NCBI)