CAS 32981-22-9 appears in our catalog under these names: 2,2,3,3,5,5,6,6-Octafluoro-1,4-dioxane, 95%, 2,2,3,3,5,5,6,6-Octafluoro-1,4-dioxane, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2,2,3,3,5,5,6,6-octafluoro-1,4-dioxane (CAS 32981-22-9) is a chemical compound with the molecular formula C4F8O2 and a molecular weight of 232.03 g/mol. IUPAC name: 2,2,3,3,5,5,6,6-octafluoro-1,4-dioxane. InChIKey: HMWAWZONWWOUGB-UHFFFAOYSA-N.
| Molecular formula | C4F8O2 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 2,2,3,3,5,5,6,6-octafluoro-1,4-dioxane |
| InChIKey | HMWAWZONWWOUGB-UHFFFAOYSA-N |
| SMILES | C1(C(OC(C(O1)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)