CAS 330-83-6 appears in our catalog under these names: 4-Fluorodiphenylamine, 96%, 4–Fluorodiphenylamine, 4-Fluorodiphenylamine, >98.0%(GC), 4-Fluoro-N-phenylaniline 98%, 4-Fluoro-N-phenylaniline, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 25g, 10g.
4-fluoro-N-phenylaniline (CAS 330-83-6) is a chemical compound with the molecular formula C12H10FN and a molecular weight of 187.21 g/mol. IUPAC name: 4-fluoro-N-phenylaniline. InChIKey: RBWCFTJQRDTIBX-UHFFFAOYSA-N.
| Molecular formula | C12H10FN |
|---|---|
| Molecular weight | 187.21 g/mol |
| IUPAC name | 4-fluoro-N-phenylaniline |
| InChIKey | RBWCFTJQRDTIBX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)