Products 33002-02-7
CAS 33002-02-7 is the registry number for (S)-(+)-Tetrahydro-furfurylamine L-Tartrate. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
(2R,3R)-2,3-dihydroxybutanedioic acid;[(2S)-oxolan-2-yl]methanamine (CAS 33002-02-7) is a chemical compound with the molecular formula C9H17NO7 and a molecular weight of 251.23 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedioic acid;[(2S)-oxolan-2-yl]methanamine. InChIKey: VWIPLFQPIIQAJW-IKQZNINXSA-N.
| Molecular formula | C9H17NO7 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxybutanedioic acid;[(2S)-oxolan-2-yl]methanamine |
| InChIKey | VWIPLFQPIIQAJW-IKQZNINXSA-N |
| SMILES | C1C[C@H](OC1)CN.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)