CAS 33012-62-3 appears in our catalog under these names: Pentaric Acid, Ribaric acid disodium salt. Offered by: TRC, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 500mg.
2,3,4-trihydroxypentanedioic acid (CAS 33012-62-3) is a chemical compound with the molecular formula C5H8O7 and a molecular weight of 180.11 g/mol. IUPAC name: 2,3,4-trihydroxypentanedioic acid. InChIKey: NPTTZSYLTYJCPR-UHFFFAOYSA-N.
| Molecular formula | C5H8O7 |
|---|---|
| Molecular weight | 180.11 g/mol |
| IUPAC name | 2,3,4-trihydroxypentanedioic acid |
| InChIKey | NPTTZSYLTYJCPR-UHFFFAOYSA-N |
| SMILES | C(C(C(=O)O)O)(C(C(=O)O)O)O |
Computed by PubChem (NCBI)