Products 330156-49-5
CAS 330156-49-5 appears in our catalog under these names: (1S)-2-Chloro-1-(2,4-difluorophenyl)ethanol, 95%, (S)-2-Chloro-1-(2,4-difluorophenyl)ethanol 98%, (S)-2-Chloro-1-(2,4-difluorophenyl)ethanol, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g.
(1S)-2-chloro-1-(2,4-difluorophenyl)ethanol (CAS 330156-49-5) is a chemical compound with the molecular formula C8H7ClF2O and a molecular weight of 192.59 g/mol. IUPAC name: (1S)-2-chloro-1-(2,4-difluorophenyl)ethanol. InChIKey: LUDHEANGPFVUIE-MRVPVSSYSA-N.
| Molecular formula | C8H7ClF2O |
|---|---|
| Molecular weight | 192.59 g/mol |
| IUPAC name | (1S)-2-chloro-1-(2,4-difluorophenyl)ethanol |
| InChIKey | LUDHEANGPFVUIE-MRVPVSSYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)[C@@H](CCl)O |
Computed by PubChem (NCBI)