CAS 33016-77-2 appears in our catalog under these names: TETRASODIUM ETHYLENE 1,1–DIPHOSPHONATE, Phosphonic acid,ethenylidenebis-, tetrasodium salt (9CI). Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g.
Dioxido-oxo-(1-phosphonatoethenyl)-lambda5-phosphane (CAS 33016-77-2) is a chemical compound with the molecular formula C2H2O6P2-4 and a molecular weight of 183.98 g/mol. IUPAC name: dioxido-oxo-(1-phosphonatoethenyl)-lambda5-phosphane. InChIKey: LUHPUPVJIVTJOE-UHFFFAOYSA-J.
| Molecular formula | C2H2O6P2-4 |
|---|---|
| Molecular weight | 183.98 g/mol |
| IUPAC name | dioxido-oxo-(1-phosphonatoethenyl)-lambda5-phosphane |
| InChIKey | LUHPUPVJIVTJOE-UHFFFAOYSA-J |
| SMILES | C=C(P(=O)([O-])[O-])P(=O)([O-])[O-] |
Computed by PubChem (NCBI)