CAS 3302-39-4 is the registry number for 1-Azido-2-bromobenzene. Offered by: TRC, Biosynth. Available pack sizes: 1g, 10g.
1-azido-2-bromobenzene (CAS 3302-39-4) is a chemical compound with the molecular formula C6H4BrN3 and a molecular weight of 198.02 g/mol. IUPAC name: 1-azido-2-bromobenzene. InChIKey: QOVQEONXPGQIHT-UHFFFAOYSA-N.
| Molecular formula | C6H4BrN3 |
|---|---|
| Molecular weight | 198.02 g/mol |
| IUPAC name | 1-azido-2-bromobenzene |
| InChIKey | QOVQEONXPGQIHT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N=[N+]=[N-])Br |
Computed by PubChem (NCBI)