CAS 33035-41-5 appears in our catalog under these names: Iodomesitylene diacetate, 98%, Iodomesitylene diacetate, 95%, Iodomesitylene Diacetate, Iodomesitylene Diacetate, Iodomesitylene Diacetate, >98.0%(T). Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 5g, 1g, 25g, 2g, 10g, 100mg, 250mg, 100g.
Acetic acid;2-iodo-1,3,5-trimethylbenzene (CAS 33035-41-5) is a chemical compound with the molecular formula C13H19IO4 and a molecular weight of 366.19 g/mol. IUPAC name: acetic acid;2-iodo-1,3,5-trimethylbenzene. InChIKey: VPNCTSRXJAONGB-UHFFFAOYSA-N.
| Molecular formula | C13H19IO4 |
|---|---|
| Molecular weight | 366.19 g/mol |
| IUPAC name | acetic acid;2-iodo-1,3,5-trimethylbenzene |
| InChIKey | VPNCTSRXJAONGB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)I)C.CC(=O)O.CC(=O)O |
Computed by PubChem (NCBI)