CAS 33049-88-6 is the registry number for 9-Allyl-2-chlorothioxanthen-9-ol. Offered by: TRC. Available pack sizes: 500mg.
2-chloro-9-prop-2-enylthioxanthen-9-ol (CAS 33049-88-6) is a chemical compound with the molecular formula C16H13ClOS and a molecular weight of 288.8 g/mol. IUPAC name: 2-chloro-9-prop-2-enylthioxanthen-9-ol. InChIKey: TVKIVQFMOWEWHQ-UHFFFAOYSA-N.
| Molecular formula | C16H13ClOS |
|---|---|
| Molecular weight | 288.8 g/mol |
| IUPAC name | 2-chloro-9-prop-2-enylthioxanthen-9-ol |
| InChIKey | TVKIVQFMOWEWHQ-UHFFFAOYSA-N |
| SMILES | C=CCC1(C2=CC=CC=C2SC3=C1C=C(C=C3)Cl)O |
Computed by PubChem (NCBI)