CAS 330562-43-1 appears in our catalog under these names: 1H,1H-Nonafluoro-3,6-dioxaheptan-1-ol, 95%, Fluorinated diethylene glycol monomethyl ether. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 5g, 1g.
2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethanol (CAS 330562-43-1) is a chemical compound with the molecular formula C5H3F9O3 and a molecular weight of 282.06 g/mol. IUPAC name: 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethanol. InChIKey: MRBIEXKSTURAOV-UHFFFAOYSA-N.
| Molecular formula | C5H3F9O3 |
|---|---|
| Molecular weight | 282.06 g/mol |
| IUPAC name | 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethanol |
| InChIKey | MRBIEXKSTURAOV-UHFFFAOYSA-N |
| SMILES | C(C(OC(C(OC(F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)