CAS 330562-48-6 appears in our catalog under these names: 1,6-Dibromo-2,5-dioxaperfluorohexane, 95%, Perfluoro-1,6-dibromo-2,5-dioxahexane, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 5g, 1g, 50g.
1,2-bis[bromo(difluoro)methoxy]-1,1,2,2-tetrafluoroethane (CAS 330562-48-6) is a chemical compound with the molecular formula C4Br2F8O2 and a molecular weight of 391.84 g/mol. IUPAC name: 1,2-bis[bromo(difluoro)methoxy]-1,1,2,2-tetrafluoroethane. InChIKey: AZSXACQJCQPNCO-UHFFFAOYSA-N.
| Molecular formula | C4Br2F8O2 |
|---|---|
| Molecular weight | 391.84 g/mol |
| IUPAC name | 1,2-bis[bromo(difluoro)methoxy]-1,1,2,2-tetrafluoroethane |
| InChIKey | AZSXACQJCQPNCO-UHFFFAOYSA-N |
| SMILES | C(C(OC(F)(F)Br)(F)F)(OC(F)(F)Br)(F)F |
Computed by PubChem (NCBI)