CAS 330640-86-3 is the registry number for N-(4-Bromophenyl)-2-(3-chlorophenyl)acetamide, 98%. Offered by: AmBeed. Available pack sizes: 5g.
N-(4-bromophenyl)-2-(3-chlorophenyl)acetamide (CAS 330640-86-3) is a chemical compound with the molecular formula C14H11BrClNO and a molecular weight of 324.60 g/mol. IUPAC name: N-(4-bromophenyl)-2-(3-chlorophenyl)acetamide. InChIKey: VZMKXUDJSFDQNF-UHFFFAOYSA-N.
| Molecular formula | C14H11BrClNO |
|---|---|
| Molecular weight | 324.60 g/mol |
| IUPAC name | N-(4-bromophenyl)-2-(3-chlorophenyl)acetamide |
| InChIKey | VZMKXUDJSFDQNF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CC(=O)NC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)