CAS 33068-19-8 appears in our catalog under these names: 2-Deoxy-d-glucose 6-phosphate sodium salt, 95%, 2–Deoxy–D–glucose 6–phosphate disodium, 2–deoxy–D–Glucose–6–phosphate (sodium salt), 2-Deoxy-D-glucose-6-phosphate sodium salt, 2-Deoxy-D-glucose 6-phosphate sodium salt, 98.00%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 250mg, 100mg, 10mg, 25mg, 50mg, 500mg, 2000mg, 1000mg.
CAS 33068-19-8 identifies a chemical compound with the molecular formula C6H13NaO8P and a molecular weight of 267.13 g/mol. InChIKey: IZNJIWLEAMRBEY-JMWSHJPJSA-N.
| Molecular formula | C6H13NaO8P |
|---|---|
| Molecular weight | 267.13 g/mol |
| InChIKey | IZNJIWLEAMRBEY-JMWSHJPJSA-N |
| SMILES | C(C=O)[C@H]([C@@H]([C@@H](COP(=O)(O)O)O)O)O.[Na] |
Computed by PubChem (NCBI)