Products 330792-86-4
CAS 330792-86-4 is the registry number for 2-(4-Iodophenoxy)pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
2-(4-iodophenoxy)pyrimidine (CAS 330792-86-4) is a chemical compound with the molecular formula C10H7IN2O and a molecular weight of 298.08 g/mol. IUPAC name: 2-(4-iodophenoxy)pyrimidine. InChIKey: ACTXYGJBAXDKAS-UHFFFAOYSA-N.
| Molecular formula | C10H7IN2O |
|---|---|
| Molecular weight | 298.08 g/mol |
| IUPAC name | 2-(4-iodophenoxy)pyrimidine |
| InChIKey | ACTXYGJBAXDKAS-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)OC2=CC=C(C=C2)I |
Computed by PubChem (NCBI)