CAS 330842-49-4 is the registry number for Pneumolysin-IN-1, 98.08%. Offered by: MedChemExpress. Available pack sizes: 10mM/1mL, 25 mg, 100 mg, 10 mg, 50 mg, 5 mg.
5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-1-(3,5-dimethylphenyl)-1,3-diazinane-2,4,6-trione (CAS 330842-49-4) is a chemical compound with the molecular formula C23H16Cl2N2O4 and a molecular weight of 455.3 g/mol. IUPAC name: 5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-1-(3,5-dimethylphenyl)-1,3-diazinane-2,4,6-trione. InChIKey: BEKTVDJDVMXKEB-UHFFFAOYSA-N.
| Molecular formula | C23H16Cl2N2O4 |
|---|---|
| Molecular weight | 455.3 g/mol |
| IUPAC name | 5-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-1-(3,5-dimethylphenyl)-1,3-diazinane-2,4,6-trione |
| InChIKey | BEKTVDJDVMXKEB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)N2C(=O)C(=CC3=CC=C(O3)C4=C(C=C(C=C4)Cl)Cl)C(=O)NC2=O)C |
Computed by PubChem (NCBI)