CAS 330997-95-0 is the registry number for Ros inhibitor, ycg063. Offered by: Biosynth. Available pack sizes: 25mg, 50mg, 100mg.
2-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-N-[(E)-1-(4-pentoxyphenyl)ethylideneamino]acetamide (CAS 330997-95-0) is a chemical compound with the molecular formula C19H25N5O4S and a molecular weight of 419.5 g/mol. IUPAC name: 2-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-N-[(E)-1-(4-pentoxyphenyl)ethylideneamino]acetamide. InChIKey: ZJJLZPIAIOLRKM-KGENOOAVSA-N.
| Molecular formula | C19H25N5O4S |
|---|---|
| Molecular weight | 419.5 g/mol |
| IUPAC name | 2-(3-methyl-5-nitroimidazol-4-yl)sulfanyl-N-[(E)-1-(4-pentoxyphenyl)ethylideneamino]acetamide |
| InChIKey | ZJJLZPIAIOLRKM-KGENOOAVSA-N |
| SMILES | CCCCCOC1=CC=C(C=C1)/C(=N/NC(=O)CSC2=C(N=CN2C)[N+](=O)[O-])/C |
Computed by PubChem (NCBI)