CAS 331248-11-4 appears in our catalog under these names: LG 101506, LG 101506, LG101506. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 500mg, 10mg, 50mg, 100 mg, 10 mg, 25 mg, 50 mg, 5 mg.
(2E,4E,6Z)-7-[3,5-ditert-butyl-2-(2,2-difluoroethoxy)phenyl]-3-methylocta-2,4,6-trienoic acid (CAS 331248-11-4) is a chemical compound with the molecular formula C25H34F2O3 and a molecular weight of 420.5 g/mol. IUPAC name: (2E,4E,6Z)-7-[3,5-ditert-butyl-2-(2,2-difluoroethoxy)phenyl]-3-methylocta-2,4,6-trienoic acid. InChIKey: BHIBZAZKKARFIM-XRYBSMBUSA-N.
| Molecular formula | C25H34F2O3 |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | (2E,4E,6Z)-7-[3,5-ditert-butyl-2-(2,2-difluoroethoxy)phenyl]-3-methylocta-2,4,6-trienoic acid |
| InChIKey | BHIBZAZKKARFIM-XRYBSMBUSA-N |
| SMILES | C/C(=C\C(=O)O)/C=C/C=C(/C)\C1=C(C(=CC(=C1)C(C)(C)C)C(C)(C)C)OCC(F)F |
Computed by PubChem (NCBI)