CAS 3314-32-7 appears in our catalog under these names: 1,2-Bis(1h-benzimidazol-2-yl)ethane-1,2-diol, 95%, 1,2-Bis(1H-benzo[d]imidazol-2-yl)ethane-1,2-diol, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
1,2-bis(1H-benzimidazol-2-yl)ethane-1,2-diol (CAS 3314-32-7) is a chemical compound with the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. IUPAC name: 1,2-bis(1H-benzimidazol-2-yl)ethane-1,2-diol. InChIKey: ALWIRKFXMNFYBB-UHFFFAOYSA-N.
| Molecular formula | C16H14N4O2 |
|---|---|
| Molecular weight | 294.31 g/mol |
| IUPAC name | 1,2-bis(1H-benzimidazol-2-yl)ethane-1,2-diol |
| InChIKey | ALWIRKFXMNFYBB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)C(C(C3=NC4=CC=CC=C4N3)O)O |
Computed by PubChem (NCBI)