CAS 33144-79-5 is the registry number for Broperamole. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[5-(3-bromophenyl)tetrazol-2-yl]-1-piperidin-1-ylpropan-1-one (CAS 33144-79-5) is a chemical compound with the molecular formula C15H18BrN5O and a molecular weight of 364.24 g/mol. IUPAC name: 3-[5-(3-bromophenyl)tetrazol-2-yl]-1-piperidin-1-ylpropan-1-one. InChIKey: PLZMRGRLCWCLFW-UHFFFAOYSA-N.
| Molecular formula | C15H18BrN5O |
|---|---|
| Molecular weight | 364.24 g/mol |
| IUPAC name | 3-[5-(3-bromophenyl)tetrazol-2-yl]-1-piperidin-1-ylpropan-1-one |
| InChIKey | PLZMRGRLCWCLFW-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)CCN2N=C(N=N2)C3=CC(=CC=C3)Br |
Computed by PubChem (NCBI)