Products 331467-05-1

CAS 331467-05-1 is the registry number for Indirubin-3'-monoxime-5-sulphonic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

2-hydroxy-3-(3-nitroso-1H-indol-2-yl)-1H-indole-5-sulfonic acid (CAS 331467-05-1) is a chemical compound with the molecular formula C16H11N3O5S and a molecular weight of 357.3 g/mol. IUPAC name: 2-hydroxy-3-(3-nitroso-1H-indol-2-yl)-1H-indole-5-sulfonic acid. InChIKey: BZZVPFDMEVQJTI-UHFFFAOYSA-N.

Identity
Molecular formulaC16H11N3O5S
Molecular weight357.3 g/mol
IUPAC name2-hydroxy-3-(3-nitroso-1H-indol-2-yl)-1H-indole-5-sulfonic acid
InChIKeyBZZVPFDMEVQJTI-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=C(N2)C3=C(NC4=C3C=C(C=C4)S(=O)(=O)O)O)N=O

Computed by PubChem (NCBI)