CAS 331467-05-1 is the registry number for Indirubin-3'-monoxime-5-sulphonic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-hydroxy-3-(3-nitroso-1H-indol-2-yl)-1H-indole-5-sulfonic acid (CAS 331467-05-1) is a chemical compound with the molecular formula C16H11N3O5S and a molecular weight of 357.3 g/mol. IUPAC name: 2-hydroxy-3-(3-nitroso-1H-indol-2-yl)-1H-indole-5-sulfonic acid. InChIKey: BZZVPFDMEVQJTI-UHFFFAOYSA-N.
| Molecular formula | C16H11N3O5S |
|---|---|
| Molecular weight | 357.3 g/mol |
| IUPAC name | 2-hydroxy-3-(3-nitroso-1H-indol-2-yl)-1H-indole-5-sulfonic acid |
| InChIKey | BZZVPFDMEVQJTI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)C3=C(NC4=C3C=C(C=C4)S(=O)(=O)O)O)N=O |
Computed by PubChem (NCBI)