CAS 331739-46-9 appears in our catalog under these names: 2-Methyl-3,5-diphenylpyrazolo(1,5-a)pyrimidin-7-ol, 97%, 2-Methyl-3,5-diphenylpyrazolo(1,5-a)pyrimidin-7-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-methyl-3,5-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (CAS 331739-46-9) is a chemical compound with the molecular formula C19H15N3O and a molecular weight of 301.3 g/mol. IUPAC name: 2-methyl-3,5-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one. InChIKey: NVNVOFVATYXYPB-UHFFFAOYSA-N.
| Molecular formula | C19H15N3O |
|---|---|
| Molecular weight | 301.3 g/mol |
| IUPAC name | 2-methyl-3,5-diphenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| InChIKey | NVNVOFVATYXYPB-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=NC(=CC(=O)N2N1)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)