Products 331749-88-3
CAS 331749-88-3 is the registry number for Centmitor-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(E)-(3-bromo-4-hydroxyphenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide (CAS 331749-88-3) is a chemical compound with the molecular formula C22H16BrN3O3 and a molecular weight of 450.3 g/mol. IUPAC name: N-[(E)-(3-bromo-4-hydroxyphenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide. InChIKey: JOGAHIHJROVAFZ-WYMPLXKRSA-N.
| Molecular formula | C22H16BrN3O3 |
|---|---|
| Molecular weight | 450.3 g/mol |
| IUPAC name | N-[(E)-(3-bromo-4-hydroxyphenyl)methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
| InChIKey | JOGAHIHJROVAFZ-WYMPLXKRSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=CC=CC=C3N2CC(=O)N/N=C/C4=CC(=C(C=C4)O)Br |
Computed by PubChem (NCBI)