CAS 331821-24-0 is the registry number for 3-(4’-Bromophenyl)-6-ethoxy-4-methylcoumarin, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-bromophenyl)-6-ethoxy-4-methylchromen-2-one (CAS 331821-24-0) is a chemical compound with the molecular formula C18H15BrO3 and a molecular weight of 359.2 g/mol. IUPAC name: 3-(4-bromophenyl)-6-ethoxy-4-methylchromen-2-one. InChIKey: HQXGATHQZYDMKR-UHFFFAOYSA-N.
| Molecular formula | C18H15BrO3 |
|---|---|
| Molecular weight | 359.2 g/mol |
| IUPAC name | 3-(4-bromophenyl)-6-ethoxy-4-methylchromen-2-one |
| InChIKey | HQXGATHQZYDMKR-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)OC(=O)C(=C2C)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)