CAS 331833-99-9 appears in our catalog under these names: (5-Bromo-1-benzofuran-2-yl)boronic acid, 98%, (5–Bromobenzofuran–2–YL)Boronic Acid, (5-Bromobenzofuran-2-yl)boronic acid 97%, (5-Bromobenzofuran-2-yl)boronic acid, 97%, 97%, (5-Bromobenzofuran-2-yl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 25g.
(5-bromo-1-benzofuran-2-yl)boronic acid (CAS 331833-99-9) is a chemical compound with the molecular formula C8H6BBrO3 and a molecular weight of 240.85 g/mol. IUPAC name: (5-bromo-1-benzofuran-2-yl)boronic acid. InChIKey: HQMBWRQPVIXJIU-UHFFFAOYSA-N.
| Molecular formula | C8H6BBrO3 |
|---|---|
| Molecular weight | 240.85 g/mol |
| IUPAC name | (5-bromo-1-benzofuran-2-yl)boronic acid |
| InChIKey | HQMBWRQPVIXJIU-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(O1)C=CC(=C2)Br)(O)O |
Computed by PubChem (NCBI)