Products 331851-78-6
CAS 331851-78-6 is the registry number for HPV18-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2-amino-1,3-benzothiazol-6-yl)-1,3-benzoxazol-5-amine (CAS 331851-78-6) is a chemical compound with the molecular formula C14H10N4OS and a molecular weight of 282.32 g/mol. IUPAC name: 2-(2-amino-1,3-benzothiazol-6-yl)-1,3-benzoxazol-5-amine. InChIKey: QWSDFTMKQIMRKB-UHFFFAOYSA-N.
| Molecular formula | C14H10N4OS |
|---|---|
| Molecular weight | 282.32 g/mol |
| IUPAC name | 2-(2-amino-1,3-benzothiazol-6-yl)-1,3-benzoxazol-5-amine |
| InChIKey | QWSDFTMKQIMRKB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C3=NC4=C(O3)C=CC(=C4)N)SC(=N2)N |
Computed by PubChem (NCBI)