CAS 3319-17-3 is the registry number for (4-nitrophenyl)-N-(3-(trifluoromethyl)phenyl)formamide. Offered by: Biosynth. Available pack sizes: 1g, 2g.
4-nitro-N-[3-(trifluoromethyl)phenyl]benzamide (CAS 3319-17-3) is a chemical compound with the molecular formula C14H9F3N2O3 and a molecular weight of 310.23 g/mol. IUPAC name: 4-nitro-N-[3-(trifluoromethyl)phenyl]benzamide. InChIKey: JJJCKJORTNOIAC-UHFFFAOYSA-N.
| Molecular formula | C14H9F3N2O3 |
|---|---|
| Molecular weight | 310.23 g/mol |
| IUPAC name | 4-nitro-N-[3-(trifluoromethyl)phenyl]benzamide |
| InChIKey | JJJCKJORTNOIAC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)C2=CC=C(C=C2)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)