CAS 331949-35-0 appears in our catalog under these names: Nexinhib 20, >95% (HPLC), Nexinhib20, Nexinhib 20, Nexinhib20 98%, Nexinhib20, 98%, 98%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 10mg, 50mg, 1mg, 5mg, 25mg, 250mg, 25 mg.
(Z)-4,4-dimethyl-1-(3-nitrophenyl)-2-(1,2,4-triazol-1-yl)pent-1-en-3-one (CAS 331949-35-0) is a chemical compound with the molecular formula C15H16N4O3 and a molecular weight of 300.31 g/mol. IUPAC name: (Z)-4,4-dimethyl-1-(3-nitrophenyl)-2-(1,2,4-triazol-1-yl)pent-1-en-3-one. InChIKey: VKSOIYNNOFGGES-JYRVWZFOSA-N.
| Molecular formula | C15H16N4O3 |
|---|---|
| Molecular weight | 300.31 g/mol |
| IUPAC name | (Z)-4,4-dimethyl-1-(3-nitrophenyl)-2-(1,2,4-triazol-1-yl)pent-1-en-3-one |
| InChIKey | VKSOIYNNOFGGES-JYRVWZFOSA-N |
| SMILES | CC(C)(C)C(=O)/C(=C/C1=CC(=CC=C1)[N+](=O)[O-])/N2C=NC=N2 |
Computed by PubChem (NCBI)