CAS 332-86-5 is the registry number for 1,1,1,7,7,7-Hexafluoroheptan-4-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,1,1,7,7,7-hexafluoroheptan-4-one (CAS 332-86-5) is a chemical compound with the molecular formula C7H8F6O and a molecular weight of 222.13 g/mol. IUPAC name: 1,1,1,7,7,7-hexafluoroheptan-4-one. InChIKey: WLFTZMAAXHUNDE-UHFFFAOYSA-N.
| Molecular formula | C7H8F6O |
|---|---|
| Molecular weight | 222.13 g/mol |
| IUPAC name | 1,1,1,7,7,7-hexafluoroheptan-4-one |
| InChIKey | WLFTZMAAXHUNDE-UHFFFAOYSA-N |
| SMILES | C(CC(F)(F)F)C(=O)CCC(F)(F)F |
Computed by PubChem (NCBI)