CAS 332026-86-5 appears in our catalog under these names: 1,2,5-Oxadiazol-3-amine, 4-(1H-benzimidazol-2-yl)-, 98%, 98%, 4-(1H-Benzimidazol-2-yl)-1,2,5-oxadiazol-3-amine, 98%, 4-(1H-Benzo[d]imidazol-2-yl)-1,2,5-oxadiazol-3-amine, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
4-(1H-benzimidazol-2-yl)-1,2,5-oxadiazol-3-amine (CAS 332026-86-5) is a chemical compound with the molecular formula C9H7N5O and a molecular weight of 201.18 g/mol. IUPAC name: 4-(1H-benzimidazol-2-yl)-1,2,5-oxadiazol-3-amine. InChIKey: QEPDSNAEMKSMGN-UHFFFAOYSA-N.
| Molecular formula | C9H7N5O |
|---|---|
| Molecular weight | 201.18 g/mol |
| IUPAC name | 4-(1H-benzimidazol-2-yl)-1,2,5-oxadiazol-3-amine |
| InChIKey | QEPDSNAEMKSMGN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)C3=NON=C3N |
Computed by PubChem (NCBI)