CAS 332073-82-2 is the registry number for N-(3-Chlorophenyl)-n'-(4,6-dimethylpyrimidin-2-yl)guanidine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(3-chlorophenyl)-2-(4,6-dimethylpyrimidin-2-yl)guanidine (CAS 332073-82-2) is a chemical compound with the molecular formula C13H14ClN5 and a molecular weight of 275.74 g/mol. IUPAC name: 1-(3-chlorophenyl)-2-(4,6-dimethylpyrimidin-2-yl)guanidine. InChIKey: FPVMOLBHYYLCCE-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN5 |
|---|---|
| Molecular weight | 275.74 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-2-(4,6-dimethylpyrimidin-2-yl)guanidine |
| InChIKey | FPVMOLBHYYLCCE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)N=C(N)NC2=CC(=CC=C2)Cl)C |
Computed by PubChem (NCBI)