CAS 332104-54-8 is the registry number for (5-Bromo-2-hydroxyphenyl)(2-chlorophenyl)methanone, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 25g.
(5-bromo-2-hydroxyphenyl)-(2-chlorophenyl)methanone (CAS 332104-54-8) is a chemical compound with the molecular formula C13H8BrClO2 and a molecular weight of 311.56 g/mol. IUPAC name: (5-bromo-2-hydroxyphenyl)-(2-chlorophenyl)methanone. InChIKey: JTYCQJZUXZTAEK-UHFFFAOYSA-N.
| Molecular formula | C13H8BrClO2 |
|---|---|
| Molecular weight | 311.56 g/mol |
| IUPAC name | (5-bromo-2-hydroxyphenyl)-(2-chlorophenyl)methanone |
| InChIKey | JTYCQJZUXZTAEK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=C(C=CC(=C2)Br)O)Cl |
Computed by PubChem (NCBI)