Products 332129-06-3

CAS 332129-06-3 is the registry number for 2-(4-Mercaptophenyl)-1,3-dioxoisoindoline-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

1,3-dioxo-2-(4-sulfanylphenyl)isoindole-5-carboxylic acid (CAS 332129-06-3) is a chemical compound with the molecular formula C15H9NO4S and a molecular weight of 299.3 g/mol. IUPAC name: 1,3-dioxo-2-(4-sulfanylphenyl)isoindole-5-carboxylic acid. InChIKey: NUXCZVSGXYONCO-UHFFFAOYSA-N.

Identity
Molecular formulaC15H9NO4S
Molecular weight299.3 g/mol
IUPAC name1,3-dioxo-2-(4-sulfanylphenyl)isoindole-5-carboxylic acid
InChIKeyNUXCZVSGXYONCO-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O)S

Computed by PubChem (NCBI)