CAS 332129-06-3 is the registry number for 2-(4-Mercaptophenyl)-1,3-dioxoisoindoline-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1,3-dioxo-2-(4-sulfanylphenyl)isoindole-5-carboxylic acid (CAS 332129-06-3) is a chemical compound with the molecular formula C15H9NO4S and a molecular weight of 299.3 g/mol. IUPAC name: 1,3-dioxo-2-(4-sulfanylphenyl)isoindole-5-carboxylic acid. InChIKey: NUXCZVSGXYONCO-UHFFFAOYSA-N.
| Molecular formula | C15H9NO4S |
|---|---|
| Molecular weight | 299.3 g/mol |
| IUPAC name | 1,3-dioxo-2-(4-sulfanylphenyl)isoindole-5-carboxylic acid |
| InChIKey | NUXCZVSGXYONCO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C3=C(C2=O)C=C(C=C3)C(=O)O)S |
Computed by PubChem (NCBI)