Products 332156-37-3
CAS 332156-37-3 is the registry number for 3-Chloro-N-(2-cyanophenyl)-1-benzothiophene-2-carboxamide. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
3-chloro-N-(2-cyanophenyl)-1-benzothiophene-2-carboxamide (CAS 332156-37-3) is a chemical compound with the molecular formula C16H9ClN2OS and a molecular weight of 312.8 g/mol. IUPAC name: 3-chloro-N-(2-cyanophenyl)-1-benzothiophene-2-carboxamide. InChIKey: UJIPSBANJVWPOU-UHFFFAOYSA-N.
| Molecular formula | C16H9ClN2OS |
|---|---|
| Molecular weight | 312.8 g/mol |
| IUPAC name | 3-chloro-N-(2-cyanophenyl)-1-benzothiophene-2-carboxamide |
| InChIKey | UJIPSBANJVWPOU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)NC(=O)C2=C(C3=CC=CC=C3S2)Cl |
Computed by PubChem (NCBI)