CAS 332163-04-9 appears in our catalog under these names: 2-[(Furan-2-carbonyl)-amino]-4,5-dimethoxy-benzoic acid, 95%, 2-((Furan-2-carbonyl)-amino)-4,5-dimethoxy-benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
2-(furan-2-carbonylamino)-4,5-dimethoxybenzoic acid (CAS 332163-04-9) is a chemical compound with the molecular formula C14H13NO6 and a molecular weight of 291.26 g/mol. IUPAC name: 2-(furan-2-carbonylamino)-4,5-dimethoxybenzoic acid. InChIKey: KZLNQJXZHDOUIA-UHFFFAOYSA-N.
| Molecular formula | C14H13NO6 |
|---|---|
| Molecular weight | 291.26 g/mol |
| IUPAC name | 2-(furan-2-carbonylamino)-4,5-dimethoxybenzoic acid |
| InChIKey | KZLNQJXZHDOUIA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)O)NC(=O)C2=CC=CO2)OC |
Computed by PubChem (NCBI)