CAS 332175-97-0 appears in our catalog under these names: 3,6–dichloro–N–(thiazol–2–yl)benzo(b)thiophene–2–carboxamide, 3,6-dichloro-N-(thiazol-2-yl)benzo[b]thiophene-2-carboxamide. Offered by: GLPBio, Chemat. Available pack sizes: 5mg.
3,6-dichloro-N-(1,3-thiazol-2-yl)-1-benzothiophene-2-carboxamide (CAS 332175-97-0) is a chemical compound with the molecular formula C12H6Cl2N2OS2 and a molecular weight of 329.2 g/mol. IUPAC name: 3,6-dichloro-N-(1,3-thiazol-2-yl)-1-benzothiophene-2-carboxamide. InChIKey: RMBBGYYJTMLZBI-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl2N2OS2 |
|---|---|
| Molecular weight | 329.2 g/mol |
| IUPAC name | 3,6-dichloro-N-(1,3-thiazol-2-yl)-1-benzothiophene-2-carboxamide |
| InChIKey | RMBBGYYJTMLZBI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)SC(=C2Cl)C(=O)NC3=NC=CS3 |
Computed by PubChem (NCBI)